C27H31NO4 — CID 18320533
3-[2-adamantylidene(methoxy)methyl]-5-methoxy-N-(4-methoxyphenyl)benzamide (PubChem CID 18320533) has the molecular formula C27H31NO4 and a molecular weight of 433.55 g/mol. Its IUPAC name is 3-[2-adamantylidene(methoxy)methyl]-5-methoxy-N-(4-methoxyphenyl)benzamide.
| Compound Name | 3-[2-adamantylidene(methoxy)methyl]-5-methoxy-N-(4-methoxyphenyl)benzamide |
|---|---|
| PubChem CID | 18320533 |
| Molecular Formula | C27H31NO4 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.23 |
| IUPAC Name | 3-[2-adamantylidene(methoxy)methyl]-5-methoxy-N-(4-methoxyphenyl)benzamide |
| SMILES | COC(=C1C2CC3CC(C2)CC1C3)c1cc(OC)cc(C(=O)Nc2ccc(OC)cc2)c1 |
| InChI | InChI=1S/C27H31NO4/c1-30-23-6-4-22(5-7-23)28-27(29)21-13-20(14-24(15-21)31-2)26(32-3)25-18-9-16-8-17(11-18)12-19(25)10-16/h4-7,13-19H,8-12H2,1-3H3,(H,28,29)/b26-25- |
| InChIKey | PZHLUTNPPFSFQU-QPLCGJKRSA-N |
| XLogP | 5.77 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|