C27H32O3 — CID 54131966
2-[methoxy-[3-methoxy-5-[(4-methoxyphenyl)methyl]phenyl]methylidene]adamantane (PubChem CID 54131966) has the molecular formula C27H32O3 and a molecular weight of 404.55 g/mol. Its IUPAC name is 2-[methoxy-[3-methoxy-5-[(4-methoxyphenyl)methyl]phenyl]methylidene]adamantane.
| Compound Name | 2-[methoxy-[3-methoxy-5-[(4-methoxyphenyl)methyl]phenyl]methylidene]adamantane |
|---|---|
| PubChem CID | 54131966 |
| Molecular Formula | C27H32O3 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.24 |
| IUPAC Name | 2-[methoxy-[3-methoxy-5-[(4-methoxyphenyl)methyl]phenyl]methylidene]adamantane |
| SMILES | COC(=C1C2CC3CC(C2)CC1C3)c1cc(Cc2ccc(OC)cc2)cc(OC)c1 |
| InChI | InChI=1S/C27H32O3/c1-28-24-6-4-17(5-7-24)8-20-14-23(16-25(15-20)29-2)27(30-3)26-21-10-18-9-19(12-21)13-22(26)11-18/h4-7,14-16,18-19,21-22H,8-13H2,1-3H3/b27-26- |
| InChIKey | NUZOKRJJVVMXLE-RQZHXJHFSA-N |
| XLogP | 6.11 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|