C23H18N4O3S — CID 159222092
2-[(6-cyano-3H-indol-2-yl)sulfanyl]-N-(2-methoxy-4-pyridin-3-yloxyphenyl)acetamide (PubChem CID 159222092) has the molecular formula C23H18N4O3S and a molecular weight of 430.49 g/mol. Its IUPAC name is 2-[(6-cyano-3H-indol-2-yl)sulfanyl]-N-(2-methoxy-4-pyridin-3-yloxyphenyl)acetamide.
| Compound Name | 2-[(6-cyano-3H-indol-2-yl)sulfanyl]-N-(2-methoxy-4-pyridin-3-yloxyphenyl)acetamide |
|---|---|
| PubChem CID | 159222092 |
| Molecular Formula | C23H18N4O3S |
| Molecular Weight | 430.49 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | 2-[(6-cyano-3H-indol-2-yl)sulfanyl]-N-(2-methoxy-4-pyridin-3-yloxyphenyl)acetamide |
| SMILES | COc1cc(Oc2cccnc2)ccc1NC(=O)CSC1=Nc2cc(C#N)ccc2C1 |
| InChI | InChI=1S/C23H18N4O3S/c1-29-21-11-17(30-18-3-2-8-25-13-18)6-7-19(21)26-22(28)14-31-23-10-16-5-4-15(12-24)9-20(16)27-23/h2-9,11,13H,10,14H2,1H3,(H,26,28) |
| InChIKey | KRUZQNGTNOEXPF-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 96.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.49 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |