C11H16O — CID 15922304
2,4-dimethylbicyclo[3.2.2]non-6-en-3-one (PubChem CID 15922304) has the molecular formula C11H16O and a molecular weight of 164.25 g/mol. Its IUPAC name is 2,4-dimethylbicyclo[3.2.2]non-6-en-3-one.
| Compound Name | 2,4-dimethylbicyclo[3.2.2]non-6-en-3-one |
|---|---|
| PubChem CID | 15922304 |
| Molecular Formula | C11H16O |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.12 |
| IUPAC Name | 2,4-dimethylbicyclo[3.2.2]non-6-en-3-one |
| SMILES | CC1C(=O)C(C)C2C=CC1CC2 |
| InChI | InChI=1S/C11H16O/c1-7-9-3-5-10(6-4-9)8(2)11(7)12/h3,5,7-10H,4,6H2,1-2H3 |
| InChIKey | YYBBODMWMNWHPX-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|