C21H20O2S2 — CID 159223173
5-methylidene-2-[[2-[2-(4-methylphenyl)sulfanylethoxy]phenyl]methylidene]thiolan-3-one (PubChem CID 159223173) has the molecular formula C21H20O2S2 and a molecular weight of 368.52 g/mol. Its IUPAC name is 5-methylidene-2-[[2-[2-(4-methylphenyl)sulfanylethoxy]phenyl]methylidene]thiolan-3-one.
| Compound Name | 5-methylidene-2-[[2-[2-(4-methylphenyl)sulfanylethoxy]phenyl]methylidene]thiolan-3-one |
|---|---|
| PubChem CID | 159223173 |
| Molecular Formula | C21H20O2S2 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | 5-methylidene-2-[[2-[2-(4-methylphenyl)sulfanylethoxy]phenyl]methylidene]thiolan-3-one |
| SMILES | C=C1CC(=O)C(=Cc2ccccc2OCCSc2ccc(C)cc2)S1 |
| InChI | InChI=1S/C21H20O2S2/c1-15-7-9-18(10-8-15)24-12-11-23-20-6-4-3-5-17(20)14-21-19(22)13-16(2)25-21/h3-10,14H,2,11-13H2,1H3 |
| InChIKey | ODTXWBRFXJGCFT-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|