C8H23N3O2S — CID 159224113
1,3-dimethylurea;methane;S-methyl N-methylcarbamothioate (PubChem CID 159224113) has the molecular formula C8H23N3O2S and a molecular weight of 225.36 g/mol. Its IUPAC name is 1,3-dimethylurea;methane;S-methyl N-methylcarbamothioate.
| Compound Name | 1,3-dimethylurea;methane;S-methyl N-methylcarbamothioate |
|---|---|
| PubChem CID | 159224113 |
| Molecular Formula | C8H23N3O2S |
| Molecular Weight | 225.36 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | 1,3-dimethylurea;methane;S-methyl N-methylcarbamothioate |
| SMILES | C.C.CNC(=O)NC.CNC(=O)SC |
| InChI | InChI=1S/C3H8N2O.C3H7NOS.2CH4/c1-4-3(6)5-2;1-4-3(5)6-2;;/h1-2H3,(H2,4,5,6);1-2H3,(H,4,5);2*1H4 |
| InChIKey | KSBJSJOFNGNACI-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.36 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|