C22H19BCl3N4O4+ — CID 159226862
2-(2-amino-4-pyridinyl)-4-chlorophenol;(5-chloro-2-hydroxycyclohexa-1,3,5-trien-1-yl)boronic acid;4-chloropyridin-2-amine (PubChem CID 159226862) has the molecular formula C22H19BCl3N4O4+ and a molecular weight of 520.59 g/mol. Its IUPAC name is 2-(2-amino-4-pyridinyl)-4-chlorophenol;(5-chloro-2-hydroxycyclohexa-1,3,5-trien-1-yl)boronic acid;4-chloropyridin-2-amine.
| Compound Name | 2-(2-amino-4-pyridinyl)-4-chlorophenol;(5-chloro-2-hydroxycyclohexa-1,3,5-trien-1-yl)boronic acid;4-chloropyridin-2-amine |
|---|---|
| PubChem CID | 159226862 |
| Molecular Formula | C22H19BCl3N4O4+ |
| Molecular Weight | 520.59 g/mol |
| Exact Mass | 519.06 |
| IUPAC Name | 2-(2-amino-4-pyridinyl)-4-chlorophenol;(5-chloro-2-hydroxycyclohexa-1,3,5-trien-1-yl)boronic acid;4-chloropyridin-2-amine |
| SMILES | Nc1cc(-c2cc(Cl)ccc2O)ccn1.Nc1cc(Cl)ccn1.OB(O)C1=C(O)[C+]=CC(Cl)=C1 |
| InChI | InChI=1S/C11H9ClN2O.C6H4BClO3.C5H5ClN2/c12-8-1-2-10(15)9(6-8)7-3-4-14-11(13)5-7;8-4-1-2-6(9)5(3-4)7(10)11;6-4-1-2-8-5(7)3-4/h1-6,15H,(H2,13,14);1,3,10-11H;1-3H,(H2,7,8)/p+1 |
| InChIKey | KSJYPGOPGSQIHM-UHFFFAOYSA-O |
| XLogP | 4.31 |
| TPSA | 158.74 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.59 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|