C37H22BrF3N2O4S — CID 159227011
[4-bromo-8-(N-(9-phenylcarbazol-2-yl)anilino)dibenzofuran-2-yl] trifluoromethanesulfonate (PubChem CID 159227011) has the molecular formula C37H22BrF3N2O4S and a molecular weight of 727.56 g/mol. Its IUPAC name is [4-bromo-8-(N-(9-phenylcarbazol-2-yl)anilino)dibenzofuran-2-yl] trifluoromethanesulfonate.
| Compound Name | [4-bromo-8-(N-(9-phenylcarbazol-2-yl)anilino)dibenzofuran-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 159227011 |
| Molecular Formula | C37H22BrF3N2O4S |
| Molecular Weight | 727.56 g/mol |
| Exact Mass | 726.04 |
| IUPAC Name | [4-bromo-8-(N-(9-phenylcarbazol-2-yl)anilino)dibenzofuran-2-yl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1cc(Br)c2oc3ccc(N(c4ccccc4)c4ccc5c6ccccc6n(-c6ccccc6)c5c4)cc3c2c1)C(F)(F)F |
| InChI | InChI=1S/C37H22BrF3N2O4S/c38-32-22-27(47-48(44,45)37(39,40)41)21-31-30-19-25(16-18-35(30)46-36(31)32)42(23-9-3-1-4-10-23)26-15-17-29-28-13-7-8-14-33(28)43(34(29)20-26)24-11-5-2-6-12-24/h1-22H |
| InChIKey | UGYYYZKRSGZTHR-UHFFFAOYSA-N |
| XLogP | 11.14 |
| TPSA | 64.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.56 |
| LogP ≤ 5 | 11.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|