C28H37N3O3 — CID 159229232
(2S)-2-(2-cyclobutyl-3-pyridinyl)-2-[(3R)-3-[4-[(7R)-5,6,7,8-tetrahydroquinolin-7-yl]butoxy]pyrrolidin-1-yl]acetic acid (PubChem CID 159229232) has the molecular formula C28H37N3O3 and a molecular weight of 463.62 g/mol. Its IUPAC name is (2S)-2-(2-cyclobutyl-3-pyridinyl)-2-[(3R)-3-[4-[(7R)-5,6,7,8-tetrahydroquinolin-7-yl]butoxy]pyrrolidin-1-yl]acetic acid.
| Compound Name | (2S)-2-(2-cyclobutyl-3-pyridinyl)-2-[(3R)-3-[4-[(7R)-5,6,7,8-tetrahydroquinolin-7-yl]butoxy]pyrrolidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 159229232 |
| Molecular Formula | C28H37N3O3 |
| Molecular Weight | 463.62 g/mol |
| Exact Mass | 463.28 |
| IUPAC Name | (2S)-2-(2-cyclobutyl-3-pyridinyl)-2-[(3R)-3-[4-[(7R)-5,6,7,8-tetrahydroquinolin-7-yl]butoxy]pyrrolidin-1-yl]acetic acid |
| SMILES | O=C(O)[C@H](c1cccnc1C1CCC1)N1CC[C@@H](OCCCC[C@@H]2CCc3cccnc3C2)C1 |
| InChI | InChI=1S/C28H37N3O3/c32-28(33)27(24-10-5-15-30-26(24)22-7-3-8-22)31-16-13-23(19-31)34-17-2-1-6-20-11-12-21-9-4-14-29-25(21)18-20/h4-5,9-10,14-15,20,22-23,27H,1-3,6-8,11-13,16-19H2,(H,32,33)/t20-,23-,27+/m1/s1 |
| InChIKey | KSRJIGVPEZZKTK-LXHIVTORSA-N |
| XLogP | 4.94 |
| TPSA | 75.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.62 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|