C3H6Ca3O11P2 — CID 159230543
tricalcium;1,1-dihydroxypropan-2-one;diphosphate (PubChem CID 159230543) has the molecular formula C3H6Ca3O11P2 and a molecular weight of 400.25 g/mol. Its IUPAC name is tricalcium;1,1-dihydroxypropan-2-one;diphosphate.
| Compound Name | tricalcium;1,1-dihydroxypropan-2-one;diphosphate |
|---|---|
| PubChem CID | 159230543 |
| Molecular Formula | C3H6Ca3O11P2 |
| Molecular Weight | 400.25 g/mol |
| Exact Mass | 399.83 |
| IUPAC Name | tricalcium;1,1-dihydroxypropan-2-one;diphosphate |
| SMILES | CC(=O)C(O)O.O=P([O-])([O-])[O-].O=P([O-])([O-])[O-].[Ca+2].[Ca+2].[Ca+2] |
| InChI | InChI=1S/C3H6O3.3Ca.2H3O4P/c1-2(4)3(5)6;;;;2*1-5(2,3)4/h3,5-6H,1H3;;;;2*(H3,1,2,3,4)/q;3*+2;;/p-6 |
| InChIKey | KSVNOVLSNDOBPT-UHFFFAOYSA-H |
| XLogP | -7.91 |
| TPSA | 230.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.25 |
| LogP ≤ 5 | -7.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|