C24H26BrNO3S — CID 15923089
methyl 4-[[2-[4-[(4-bromophenoxy)methyl]-2,5-dimethylthiophen-3-yl]ethylamino]methyl]benzoate (PubChem CID 15923089) has the molecular formula C24H26BrNO3S and a molecular weight of 488.45 g/mol. Its IUPAC name is methyl 4-[[2-[4-[(4-bromophenoxy)methyl]-2,5-dimethylthiophen-3-yl]ethylamino]methyl]benzoate.
| Compound Name | methyl 4-[[2-[4-[(4-bromophenoxy)methyl]-2,5-dimethylthiophen-3-yl]ethylamino]methyl]benzoate |
|---|---|
| PubChem CID | 15923089 |
| Molecular Formula | C24H26BrNO3S |
| Molecular Weight | 488.45 g/mol |
| Exact Mass | 487.08 |
| IUPAC Name | methyl 4-[[2-[4-[(4-bromophenoxy)methyl]-2,5-dimethylthiophen-3-yl]ethylamino]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CNCCc2c(C)sc(C)c2COc2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C24H26BrNO3S/c1-16-22(12-13-26-14-18-4-6-19(7-5-18)24(27)28-3)23(17(2)30-16)15-29-21-10-8-20(25)9-11-21/h4-11,26H,12-15H2,1-3H3 |
| InChIKey | YGBRFLVGHVQVKP-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.45 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|