C17H22N6O — CID 159238597
2,2-dideuterio-1-[(4R,5R)-2,2,3,3,4,6,6-heptadeuterio-5-[(5-deuterio-6-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)-(trideuteriomethyl)amino]-4-methylpiperidin-1-yl]-2-isocyanoethanone (PubChem CID 159238597) has the molecular formula C17H22N6O and a molecular weight of 339.48 g/mol. Its IUPAC name is 2,2-dideuterio-1-[(4R,5R)-2,2,3,3,4,6,6-heptadeuterio-5-[(5-deuterio-6-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)-(trideuteriomethyl)amino]-4-methylpiperidin-1-yl]-2-isocyanoethanone.
| Compound Name | 2,2-dideuterio-1-[(4R,5R)-2,2,3,3,4,6,6-heptadeuterio-5-[(5-deuterio-6-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)-(trideuteriomethyl)amino]-4-methylpiperidin-1-yl]-2-isocyanoethanone |
|---|---|
| PubChem CID | 159238597 |
| Molecular Formula | C17H22N6O |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.27 |
| IUPAC Name | 2,2-dideuterio-1-[(4R,5R)-2,2,3,3,4,6,6-heptadeuterio-5-[(5-deuterio-6-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)-(trideuteriomethyl)amino]-4-methylpiperidin-1-yl]-2-isocyanoethanone |
| SMILES | [2H]c1c(C)[nH]c2ncnc(N([C@H]3C([2H])([2H])N(C(=O)C([2H])([2H])[N+]#[C-])C([2H])([2H])C([2H])([2H])[C@@]3([2H])C)C([2H])([2H])[2H])c12 |
| InChI | InChI=1S/C17H22N6O/c1-11-5-6-23(15(24)8-18-3)9-14(11)22(4)17-13-7-12(2)21-16(13)19-10-20-17/h7,10-11,14H,5-6,8-9H2,1-2,4H3,(H,19,20,21)/t11-,14+/m1/s1/i4D3,5D2,6D2,7D,8D2,9D2,11D |
| InChIKey | YSHXCOZZOBGGME-MQKNSZPRSA-N |
| XLogP | 1.86 |
| TPSA | 69.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|