C31H18N2O+2 — CID 159242397
19-phenyl-16-oxa-5,27-diazoniaoctacyclo[15.10.1.01,5.02,15.03,12.04,9.021,28.022,27]octacosa-2(15),3(12),4(9),5,7,10,13,17,19,21(28),22,24,26-tridecaene (PubChem CID 159242397) has the molecular formula C31H18N2O+2 and a molecular weight of 434.50 g/mol. Its IUPAC name is 19-phenyl-16-oxa-5,27-diazoniaoctacyclo[15.10.1.01,5.02,15.03,12.04,9.021,28.022,27]octacosa-2(15),3(12),4(9),5,7,10,13,17,19,21(28),22,24,26-tridecaene.
| Compound Name | 19-phenyl-16-oxa-5,27-diazoniaoctacyclo[15.10.1.01,5.02,15.03,12.04,9.021,28.022,27]octacosa-2(15),3(12),4(9),5,7,10,13,17,19,21(28),22,24,26-tridecaene |
|---|---|
| PubChem CID | 159242397 |
| Molecular Formula | C31H18N2O+2 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | 19-phenyl-16-oxa-5,27-diazoniaoctacyclo[15.10.1.01,5.02,15.03,12.04,9.021,28.022,27]octacosa-2(15),3(12),4(9),5,7,10,13,17,19,21(28),22,24,26-tridecaene |
| SMILES | c1ccc(-c2cc3c4c(c2)-c2cccc[n+]2C42c4c(ccc5ccc6ccc[n+]2c6c45)O3)cc1 |
| InChI | InChI=1S/C31H18N2O/c1-2-7-19(8-3-1)22-17-23-24-10-4-5-15-32(24)31-28(23)26(18-22)34-25-14-13-20-11-12-21-9-6-16-33(31)30(21)27(20)29(25)31/h1-18H/q+2 |
| InChIKey | LFSIVWKPZHPSGQ-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 16.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|