About methane;1-methoxyethenyl(methyl)azanide;ruthenium(1+)
methane;1-methoxyethenyl(methyl)azanide;ruthenium(1+) (PubChem CID 159247206) has the molecular formula C5H12NORu
and a molecular weight of 203.23 g/mol. Its IUPAC name is methane;1-methoxyethenyl(methyl)azanide;ruthenium(1+).
Molecular Properties
| Compound Name | methane;1-methoxyethenyl(methyl)azanide;ruthenium(1+) |
| PubChem CID | 159247206 |
| Molecular Formula | C5H12NORu |
| Molecular Weight | 203.23 g/mol |
| Exact Mass | 204.00 |
| IUPAC Name | methane;1-methoxyethenyl(methyl)azanide;ruthenium(1+) |
| SMILES | C.C=C([N-]C)OC.[Ru+] |
| InChI | InChI=1S/C4H8NO.CH4.Ru/c1-4(5-2)6-3;;/h1H2,2-3H3;1H4;/q-1;;+1 |
| InChIKey | KUVGBBOKRSWMQX-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 23.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.23 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze methane;1-methoxyethenyl(methyl)azanide;ruthenium(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;1-methoxyethenyl(methyl)azanide;ruthenium(1+)?
The IUPAC name of methane;1-methoxyethenyl(methyl)azanide;ruthenium(1+) (CID 159247206) is methane;1-methoxyethenyl(methyl)azanide;ruthenium(1+).
What is the SMILES notation for methane;1-methoxyethenyl(methyl)azanide;ruthenium(1+)?
The canonical SMILES for methane;1-methoxyethenyl(methyl)azanide;ruthenium(1+) is C.C=C([N-]C)OC.[Ru+].
What is the InChIKey of methane;1-methoxyethenyl(methyl)azanide;ruthenium(1+)?
The InChIKey is KUVGBBOKRSWMQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8NO.CH4.Ru/c1-4(5-2)6-3;;/h1H2,2-3H3;1H4;/q-1;;+1.
What are the key properties of methane;1-methoxyethenyl(methyl)azanide;ruthenium(1+)?
methane;1-methoxyethenyl(methyl)azanide;ruthenium(1+) has a molecular weight of 203.23 g/mol, XLogP of 1.74, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for methane;1-methoxyethenyl(methyl)azanide;ruthenium(1+) is sourced from PubChem (CID 159247206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).