C22H19N3O4 — CID 159248331
methyl 6-[[4-(2-cyanophenyl)phenyl]methylamino]-6-nitrocyclohexa-2,4-diene-1-carboxylate (PubChem CID 159248331) has the molecular formula C22H19N3O4 and a molecular weight of 389.41 g/mol. Its IUPAC name is methyl 6-[[4-(2-cyanophenyl)phenyl]methylamino]-6-nitrocyclohexa-2,4-diene-1-carboxylate.
| Compound Name | methyl 6-[[4-(2-cyanophenyl)phenyl]methylamino]-6-nitrocyclohexa-2,4-diene-1-carboxylate |
|---|---|
| PubChem CID | 159248331 |
| Molecular Formula | C22H19N3O4 |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | methyl 6-[[4-(2-cyanophenyl)phenyl]methylamino]-6-nitrocyclohexa-2,4-diene-1-carboxylate |
| SMILES | COC(=O)C1C=CC=CC1(NCc1ccc(-c2ccccc2C#N)cc1)[N+](=O)[O-] |
| InChI | InChI=1S/C22H19N3O4/c1-29-21(26)20-8-4-5-13-22(20,25(27)28)24-15-16-9-11-17(12-10-16)19-7-3-2-6-18(19)14-23/h2-13,20,24H,15H2,1H3 |
| InChIKey | KUYQELZEUUZSPQ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 105.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|