C22H18N2O2 — CID 18693016
methyl 3-amino-2-[[4-(2-cyanophenyl)phenyl]methyl]benzoate (PubChem CID 18693016) has the molecular formula C22H18N2O2 and a molecular weight of 342.40 g/mol. Its IUPAC name is methyl 3-amino-2-[[4-(2-cyanophenyl)phenyl]methyl]benzoate.
| Compound Name | methyl 3-amino-2-[[4-(2-cyanophenyl)phenyl]methyl]benzoate |
|---|---|
| PubChem CID | 18693016 |
| Molecular Formula | C22H18N2O2 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | methyl 3-amino-2-[[4-(2-cyanophenyl)phenyl]methyl]benzoate |
| SMILES | COC(=O)c1cccc(N)c1Cc1ccc(-c2ccccc2C#N)cc1 |
| InChI | InChI=1S/C22H18N2O2/c1-26-22(25)19-7-4-8-21(24)20(19)13-15-9-11-16(12-10-15)18-6-3-2-5-17(18)14-23/h2-12H,13,24H2,1H3 |
| InChIKey | WHTCKIVJTVNDGY-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 76.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|