C25H24N4O3S — CID 87871007
methyl 2-[[4-(2-cyanophenyl)phenyl]methylamino]-3-[ethylcarbamoyl(sulfanyl)amino]benzoate (PubChem CID 87871007) has the molecular formula C25H24N4O3S and a molecular weight of 460.56 g/mol. Its IUPAC name is methyl 2-[[4-(2-cyanophenyl)phenyl]methylamino]-3-[ethylcarbamoyl(sulfanyl)amino]benzoate.
| Compound Name | methyl 2-[[4-(2-cyanophenyl)phenyl]methylamino]-3-[ethylcarbamoyl(sulfanyl)amino]benzoate |
|---|---|
| PubChem CID | 87871007 |
| Molecular Formula | C25H24N4O3S |
| Molecular Weight | 460.56 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | methyl 2-[[4-(2-cyanophenyl)phenyl]methylamino]-3-[ethylcarbamoyl(sulfanyl)amino]benzoate |
| SMILES | CCNC(=O)N(S)c1cccc(C(=O)OC)c1NCc1ccc(-c2ccccc2C#N)cc1 |
| InChI | InChI=1S/C25H24N4O3S/c1-3-27-25(31)29(33)22-10-6-9-21(24(30)32-2)23(22)28-16-17-11-13-18(14-12-17)20-8-5-4-7-19(20)15-26/h4-14,28,33H,3,16H2,1-2H3,(H,27,31) |
| InChIKey | FBUUCEVZKIDRTA-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 94.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.56 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|