C44H51BBrN6O10 — CID 159252999
CID 159252999 (PubChem CID 159252999) has the molecular formula C44H51BBrN6O10 and a molecular weight of 914.64 g/mol.
| Compound Name | CID 159252999 |
|---|---|
| PubChem CID | 159252999 |
| Molecular Formula | C44H51BBrN6O10 |
| Molecular Weight | 914.64 g/mol |
| Exact Mass | 913.29 |
| IUPAC Name | — |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H](Oc2cc(-c3ccc(O)cc3)cn3cncc23)C1.CC(C)(C)OC(=O)N1CC[C@H](Oc2cc(Br)cn3cncc23)C1.O[B]Oc1ccc(O)cc1 |
| InChI | InChI=1S/C22H25N3O4.C16H20BrN3O3.C6H6BO3/c1-22(2,3)29-21(27)24-9-8-18(13-24)28-20-10-16(12-25-14-23-11-19(20)25)15-4-6-17(26)7-5-15;1-16(2,3)23-15(21)19-5-4-12(9-19)22-14-6-11(17)8-20-10-18-7-13(14)20;8-5-1-3-6(4-2-5)10-7-9/h4-7,10-12,14,18,26H,8-9,13H2,1-3H3;6-8,10,12H,4-5,9H2,1-3H3;1-4,8-9H/t18-;12-;/m00./s1 |
| InChIKey | HGADYIJAWXCORE-WLEOJCQLSA-N |
| XLogP | 7.88 |
| TPSA | 182.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 914.64 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|