About [imidazol-1-yl(diphenyl)methyl]-(3-methylbut-1-enyl)silane;triphenylborane
[imidazol-1-yl(diphenyl)methyl]-(3-methylbut-1-enyl)silane;triphenylborane (PubChem CID 159254824) has the molecular formula C39H39BN2Si
and a molecular weight of 574.65 g/mol. Its IUPAC name is [imidazol-1-yl(diphenyl)methyl]-(3-methylbut-1-enyl)silane;triphenylborane.
Molecular Properties
| Compound Name | [imidazol-1-yl(diphenyl)methyl]-(3-methylbut-1-enyl)silane;triphenylborane |
| PubChem CID | 159254824 |
| Molecular Formula | C39H39BN2Si |
| Molecular Weight | 574.65 g/mol |
| Exact Mass | 574.30 |
| IUPAC Name | [imidazol-1-yl(diphenyl)methyl]-(3-methylbut-1-enyl)silane;triphenylborane |
| SMILES | CC(C)C=C[SiH2]C(c1ccccc1)(c1ccccc1)n1ccnc1.c1ccc(B(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H24N2Si.C18H15B/c1-18(2)13-16-24-21(23-15-14-22-17-23,19-9-5-3-6-10-19)20-11-7-4-8-12-20;1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18/h3-18H,24H2,1-2H3;1-15H |
| InChIKey | KVTJJEVEUCMHNN-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 574.65 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [imidazol-1-yl(diphenyl)methyl]-(3-methylbut-1-enyl)silane;triphenylborane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [imidazol-1-yl(diphenyl)methyl]-(3-methylbut-1-enyl)silane;triphenylborane?
The IUPAC name of [imidazol-1-yl(diphenyl)methyl]-(3-methylbut-1-enyl)silane;triphenylborane (CID 159254824) is [imidazol-1-yl(diphenyl)methyl]-(3-methylbut-1-enyl)silane;triphenylborane.
What is the SMILES notation for [imidazol-1-yl(diphenyl)methyl]-(3-methylbut-1-enyl)silane;triphenylborane?
The canonical SMILES for [imidazol-1-yl(diphenyl)methyl]-(3-methylbut-1-enyl)silane;triphenylborane is CC(C)C=C[SiH2]C(c1ccccc1)(c1ccccc1)n1ccnc1.c1ccc(B(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of [imidazol-1-yl(diphenyl)methyl]-(3-methylbut-1-enyl)silane;triphenylborane?
The InChIKey is KVTJJEVEUCMHNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24N2Si.C18H15B/c1-18(2)13-16-24-21(23-15-14-22-17-23,19-9-5-3-6-10-19)20-11-7-4-8-12-20;1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18/h3-18H,24H2,1-2H3;1-15H.
What are the key properties of [imidazol-1-yl(diphenyl)methyl]-(3-methylbut-1-enyl)silane;triphenylborane?
[imidazol-1-yl(diphenyl)methyl]-(3-methylbut-1-enyl)silane;triphenylborane has a molecular weight of 574.65 g/mol, XLogP of 6.17, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [imidazol-1-yl(diphenyl)methyl]-(3-methylbut-1-enyl)silane;triphenylborane is sourced from PubChem (CID 159254824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).