About ethenyl(diphenyl)borane;[imidazol-1-yl(diphenyl)methyl]-(2-methylbut-2-enyl)silane
ethenyl(diphenyl)borane;[imidazol-1-yl(diphenyl)methyl]-(2-methylbut-2-enyl)silane (PubChem CID 173368184) has the molecular formula C35H37BN2Si
and a molecular weight of 524.59 g/mol. Its IUPAC name is ethenyl(diphenyl)borane;[imidazol-1-yl(diphenyl)methyl]-(2-methylbut-2-enyl)silane.
Molecular Properties
| Compound Name | ethenyl(diphenyl)borane;[imidazol-1-yl(diphenyl)methyl]-(2-methylbut-2-enyl)silane |
| PubChem CID | 173368184 |
| Molecular Formula | C35H37BN2Si |
| Molecular Weight | 524.59 g/mol |
| Exact Mass | 524.28 |
| IUPAC Name | ethenyl(diphenyl)borane;[imidazol-1-yl(diphenyl)methyl]-(2-methylbut-2-enyl)silane |
| SMILES | C=CB(c1ccccc1)c1ccccc1.CC=C(C)C[SiH2]C(c1ccccc1)(c1ccccc1)n1ccnc1 |
| InChI | InChI=1S/C21H24N2Si.C14H13B/c1-3-18(2)16-24-21(23-15-14-22-17-23,19-10-6-4-7-11-19)20-12-8-5-9-13-20;1-2-15(13-9-5-3-6-10-13)14-11-7-4-8-12-14/h3-15,17H,16,24H2,1-2H3;2-12H,1H2 |
| InChIKey | PVPUETLQTUDFER-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 524.59 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethenyl(diphenyl)borane;[imidazol-1-yl(diphenyl)methyl]-(2-methylbut-2-enyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenyl(diphenyl)borane;[imidazol-1-yl(diphenyl)methyl]-(2-methylbut-2-enyl)silane?
The IUPAC name of ethenyl(diphenyl)borane;[imidazol-1-yl(diphenyl)methyl]-(2-methylbut-2-enyl)silane (CID 173368184) is ethenyl(diphenyl)borane;[imidazol-1-yl(diphenyl)methyl]-(2-methylbut-2-enyl)silane.
What is the SMILES notation for ethenyl(diphenyl)borane;[imidazol-1-yl(diphenyl)methyl]-(2-methylbut-2-enyl)silane?
The canonical SMILES for ethenyl(diphenyl)borane;[imidazol-1-yl(diphenyl)methyl]-(2-methylbut-2-enyl)silane is C=CB(c1ccccc1)c1ccccc1.CC=C(C)C[SiH2]C(c1ccccc1)(c1ccccc1)n1ccnc1.
What is the InChIKey of ethenyl(diphenyl)borane;[imidazol-1-yl(diphenyl)methyl]-(2-methylbut-2-enyl)silane?
The InChIKey is PVPUETLQTUDFER-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24N2Si.C14H13B/c1-3-18(2)16-24-21(23-15-14-22-17-23,19-10-6-4-7-11-19)20-12-8-5-9-13-20;1-2-15(13-9-5-3-6-10-13)14-11-7-4-8-12-14/h3-15,17H,16,24H2,1-2H3;2-12H,1H2.
What are the key properties of ethenyl(diphenyl)borane;[imidazol-1-yl(diphenyl)methyl]-(2-methylbut-2-enyl)silane?
ethenyl(diphenyl)borane;[imidazol-1-yl(diphenyl)methyl]-(2-methylbut-2-enyl)silane has a molecular weight of 524.59 g/mol, XLogP of 6.21, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethenyl(diphenyl)borane;[imidazol-1-yl(diphenyl)methyl]-(2-methylbut-2-enyl)silane is sourced from PubChem (CID 173368184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).