C37H41BN2Si — CID 158251515
cyclopropyl(diphenyl)borane;[imidazol-1-yl(diphenyl)methyl]-(3-methylpent-3-enyl)silane (PubChem CID 158251515) has the molecular formula C37H41BN2Si and a molecular weight of 552.65 g/mol. Its IUPAC name is cyclopropyl(diphenyl)borane;[imidazol-1-yl(diphenyl)methyl]-(3-methylpent-3-enyl)silane.
| Compound Name | cyclopropyl(diphenyl)borane;[imidazol-1-yl(diphenyl)methyl]-(3-methylpent-3-enyl)silane |
|---|---|
| PubChem CID | 158251515 |
| Molecular Formula | C37H41BN2Si |
| Molecular Weight | 552.65 g/mol |
| Exact Mass | 552.31 |
| IUPAC Name | cyclopropyl(diphenyl)borane;[imidazol-1-yl(diphenyl)methyl]-(3-methylpent-3-enyl)silane |
| SMILES | CC=C(C)CC[SiH2]C(c1ccccc1)(c1ccccc1)n1ccnc1.c1ccc(B(c2ccccc2)C2CC2)cc1 |
| InChI | InChI=1S/C22H26N2Si.C15H15B/c1-3-19(2)14-17-25-22(24-16-15-23-18-24,20-10-6-4-7-11-20)21-12-8-5-9-13-21;1-3-7-13(8-4-1)16(15-11-12-15)14-9-5-2-6-10-14/h3-13,15-16,18H,14,17,25H2,1-2H3;1-10,15H,11-12H2 |
| InChIKey | GGTQNNSINCPHST-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.65 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|