C40H41BN2OSi — CID 159224210
cyclopropyl(diphenyl)borane;[imidazol-1-yl(diphenyl)methyl]-(3-propoxyphenyl)silane (PubChem CID 159224210) has the molecular formula C40H41BN2OSi and a molecular weight of 604.68 g/mol. Its IUPAC name is cyclopropyl(diphenyl)borane;[imidazol-1-yl(diphenyl)methyl]-(3-propoxyphenyl)silane.
| Compound Name | cyclopropyl(diphenyl)borane;[imidazol-1-yl(diphenyl)methyl]-(3-propoxyphenyl)silane |
|---|---|
| PubChem CID | 159224210 |
| Molecular Formula | C40H41BN2OSi |
| Molecular Weight | 604.68 g/mol |
| Exact Mass | 604.31 |
| IUPAC Name | cyclopropyl(diphenyl)borane;[imidazol-1-yl(diphenyl)methyl]-(3-propoxyphenyl)silane |
| SMILES | CCCOc1cccc([SiH2]C(c2ccccc2)(c2ccccc2)n2ccnc2)c1.c1ccc(B(c2ccccc2)C2CC2)cc1 |
| InChI | InChI=1S/C25H26N2OSi.C15H15B/c1-2-18-28-23-14-9-15-24(19-23)29-25(27-17-16-26-20-27,21-10-5-3-6-11-21)22-12-7-4-8-13-22;1-3-7-13(8-4-1)16(15-11-12-15)14-9-5-2-6-10-14/h3-17,19-20H,2,18,29H2,1H3;1-10,15H,11-12H2 |
| InChIKey | KSBSKNRYHGLXBD-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.68 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|