About CID 67903950
CID 67903950 (PubChem CID 67903950) has the molecular formula C25H24N2OSi
and a molecular weight of 396.57 g/mol.
Molecular Properties
| Compound Name | CID 67903950 |
| PubChem CID | 67903950 |
| Molecular Formula | C25H24N2OSi |
| Molecular Weight | 396.57 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | — |
| SMILES | CCCOc1cccc([Si]C(c2ccccc2)(c2ccccc2)n2ccnc2)c1 |
| InChI | InChI=1S/C25H24N2OSi/c1-2-18-28-23-14-9-15-24(19-23)29-25(27-17-16-26-20-27,21-10-5-3-6-11-21)22-12-7-4-8-13-22/h3-17,19-20H,2,18H2,1H3 |
| InChIKey | XRCRZICDHBVPIP-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.57 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 67903950 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 67903950?
The IUPAC name of CID 67903950 (CID 67903950) is not available.
What is the SMILES notation for CID 67903950?
The canonical SMILES for CID 67903950 is CCCOc1cccc([Si]C(c2ccccc2)(c2ccccc2)n2ccnc2)c1.
What is the InChIKey of CID 67903950?
The InChIKey is XRCRZICDHBVPIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H24N2OSi/c1-2-18-28-23-14-9-15-24(19-23)29-25(27-17-16-26-20-27,21-10-5-3-6-11-21)22-12-7-4-8-13-22/h3-17,19-20H,2,18H2,1H3.
What are the key properties of CID 67903950?
CID 67903950 has a molecular weight of 396.57 g/mol, XLogP of 4.45, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 67903950 is sourced from PubChem (CID 67903950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).