About CID 160574681
CID 160574681 (PubChem CID 160574681) has the molecular formula C39H39BN2OSi
and a molecular weight of 590.65 g/mol.
Molecular Properties
| Compound Name | CID 160574681 |
| PubChem CID | 160574681 |
| Molecular Formula | C39H39BN2OSi |
| Molecular Weight | 590.65 g/mol |
| Exact Mass | 590.29 |
| IUPAC Name | — |
| SMILES | CCCCOc1cccc([SiH2]C(c2ccccc2)(c2ccccc2)n2ccnc2)c1.[B]C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H28N2OSi.C13H11B/c1-2-3-19-29-24-15-10-16-25(20-24)30-26(28-18-17-27-21-28,22-11-6-4-7-12-22)23-13-8-5-9-14-23;14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h4-18,20-21H,2-3,19,30H2,1H3;1-10,13H |
| InChIKey | SRVQTKFWWAMBFY-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 590.65 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 160574681 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 160574681?
The IUPAC name of CID 160574681 (CID 160574681) is not available.
What is the SMILES notation for CID 160574681?
The canonical SMILES for CID 160574681 is CCCCOc1cccc([SiH2]C(c2ccccc2)(c2ccccc2)n2ccnc2)c1.[B]C(c1ccccc1)c1ccccc1.
What is the InChIKey of CID 160574681?
The InChIKey is SRVQTKFWWAMBFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H28N2OSi.C13H11B/c1-2-3-19-29-24-15-10-16-25(20-24)30-26(28-18-17-27-21-28,22-11-6-4-7-12-22)23-13-8-5-9-14-23;14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h4-18,20-21H,2-3,19,30H2,1H3;1-10,13H.
What are the key properties of CID 160574681?
CID 160574681 has a molecular weight of 590.65 g/mol, XLogP of 7.25, 11 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 160574681 is sourced from PubChem (CID 160574681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).