C15H21NO — CID 15925776
2-(2,3-dihydro-1H-inden-1-ylamino)cyclohexan-1-ol (PubChem CID 15925776) has the molecular formula C15H21NO and a molecular weight of 231.34 g/mol. Its IUPAC name is 2-(2,3-dihydro-1H-inden-1-ylamino)cyclohexan-1-ol.
| Compound Name | 2-(2,3-dihydro-1H-inden-1-ylamino)cyclohexan-1-ol |
|---|---|
| PubChem CID | 15925776 |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | 2-(2,3-dihydro-1H-inden-1-ylamino)cyclohexan-1-ol |
| SMILES | OC1CCCCC1NC1CCc2ccccc21 |
| InChI | InChI=1S/C15H21NO/c17-15-8-4-3-7-14(15)16-13-10-9-11-5-1-2-6-12(11)13/h1-2,5-6,13-17H,3-4,7-10H2 |
| InChIKey | HJLPABFCTRFICV-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |