C19H28N2 — CID 79539274
N-(2-pyrrolidin-2-ylcyclohexyl)-2,3-dihydro-1H-inden-1-amine (PubChem CID 79539274) has the molecular formula C19H28N2 and a molecular weight of 284.45 g/mol. Its IUPAC name is N-(2-pyrrolidin-2-ylcyclohexyl)-2,3-dihydro-1H-inden-1-amine.
| Compound Name | N-(2-pyrrolidin-2-ylcyclohexyl)-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 79539274 |
| Molecular Formula | C19H28N2 |
| Molecular Weight | 284.45 g/mol |
| Exact Mass | 284.23 |
| IUPAC Name | N-(2-pyrrolidin-2-ylcyclohexyl)-2,3-dihydro-1H-inden-1-amine |
| SMILES | c1ccc2c(c1)CCC2NC1CCCCC1C1CCCN1 |
| InChI | InChI=1S/C19H28N2/c1-2-7-15-14(6-1)11-12-19(15)21-18-9-4-3-8-16(18)17-10-5-13-20-17/h1-2,6-7,16-21H,3-5,8-13H2 |
| InChIKey | LLUDTERDBMJMIL-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.45 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |