C19H25N7O2 — CID 159258450
N-(2-amino-2-iminoethyl)-2-methylbenzamide;5-(2-methylphenyl)-1H-1,2,4-triazol-3-amine;hydrate (PubChem CID 159258450) has the molecular formula C19H25N7O2 and a molecular weight of 383.46 g/mol. Its IUPAC name is N-(2-amino-2-iminoethyl)-2-methylbenzamide;5-(2-methylphenyl)-1H-1,2,4-triazol-3-amine;hydrate.
| Compound Name | N-(2-amino-2-iminoethyl)-2-methylbenzamide;5-(2-methylphenyl)-1H-1,2,4-triazol-3-amine;hydrate |
|---|---|
| PubChem CID | 159258450 |
| Molecular Formula | C19H25N7O2 |
| Molecular Weight | 383.46 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | N-(2-amino-2-iminoethyl)-2-methylbenzamide;5-(2-methylphenyl)-1H-1,2,4-triazol-3-amine;hydrate |
| SMILES | Cc1ccccc1-c1nc(N)n[nH]1.O.[H]/N=C(\N)CNC(=O)c1ccccc1C |
| InChI | InChI=1S/C10H13N3O.C9H10N4.H2O/c1-7-4-2-3-5-8(7)10(14)13-6-9(11)12;1-6-4-2-3-5-7(6)8-11-9(10)13-12-8;/h2-5H,6H2,1H3,(H3,11,12)(H,13,14);2-5H,1H3,(H3,10,11,12,13);1H2 |
| InChIKey | YNFUOCPXQLMNHJ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 178.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.46 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|