C38H50BBrN6O6 — CID 159258771
6-bromo-1H-benzimidazole;tert-butyl 3-(3H-benzimidazol-5-yl)-2,5-dihydropyrrole-1-carboxylate;tert-butyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,5-dihydropyrrole-1-carboxylate (PubChem CID 159258771) has the molecular formula C38H50BBrN6O6 and a molecular weight of 777.57 g/mol. Its IUPAC name is 6-bromo-1H-benzimidazole;tert-butyl 3-(3H-benzimidazol-5-yl)-2,5-dihydropyrrole-1-carboxylate;tert-butyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,5-dihydropyrrole-1-carboxylate.
| Compound Name | 6-bromo-1H-benzimidazole;tert-butyl 3-(3H-benzimidazol-5-yl)-2,5-dihydropyrrole-1-carboxylate;tert-butyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,5-dihydropyrrole-1-carboxylate |
|---|---|
| PubChem CID | 159258771 |
| Molecular Formula | C38H50BBrN6O6 |
| Molecular Weight | 777.57 g/mol |
| Exact Mass | 776.31 |
| IUPAC Name | 6-bromo-1H-benzimidazole;tert-butyl 3-(3H-benzimidazol-5-yl)-2,5-dihydropyrrole-1-carboxylate;tert-butyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,5-dihydropyrrole-1-carboxylate |
| SMILES | Brc1ccc2nc[nH]c2c1.CC(C)(C)OC(=O)N1CC=C(B2OC(C)(C)C(C)(C)O2)C1.CC(C)(C)OC(=O)N1CC=C(c2ccc3nc[nH]c3c2)C1 |
| InChI | InChI=1S/C16H19N3O2.C15H26BNO4.C7H5BrN2/c1-16(2,3)21-15(20)19-7-6-12(9-19)11-4-5-13-14(8-11)18-10-17-13;1-13(2,3)19-12(18)17-9-8-11(10-17)16-20-14(4,5)15(6,7)21-16;8-5-1-2-6-7(3-5)10-4-9-6/h4-6,8,10H,7,9H2,1-3H3,(H,17,18);8H,9-10H2,1-7H3;1-4H,(H,9,10) |
| InChIKey | KWFWKCYZTQDXPG-UHFFFAOYSA-N |
| XLogP | 8.32 |
| TPSA | 134.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 777.57 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|