C16H22O4S2 — CID 159262059
methane;[(2S,3S,4S)-2-methyl-3-methylsulfanylcarbothioyloxyoxan-4-yl] benzoate (PubChem CID 159262059) has the molecular formula C16H22O4S2 and a molecular weight of 342.48 g/mol. Its IUPAC name is methane;[(2S,3S,4S)-2-methyl-3-methylsulfanylcarbothioyloxyoxan-4-yl] benzoate.
| Compound Name | methane;[(2S,3S,4S)-2-methyl-3-methylsulfanylcarbothioyloxyoxan-4-yl] benzoate |
|---|---|
| PubChem CID | 159262059 |
| Molecular Formula | C16H22O4S2 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | methane;[(2S,3S,4S)-2-methyl-3-methylsulfanylcarbothioyloxyoxan-4-yl] benzoate |
| SMILES | C.CSC(=S)O[C@H]1[C@H](C)OCC[C@@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C15H18O4S2.CH4/c1-10-13(19-15(20)21-2)12(8-9-17-10)18-14(16)11-6-4-3-5-7-11;/h3-7,10,12-13H,8-9H2,1-2H3;1H4/t10-,12-,13-;/m0./s1 |
| InChIKey | KWQFNJOZHWORBW-VHJJOGJUSA-N |
| XLogP | 3.69 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|