C24H30ClN3O2S — CID 159270722
1-(1'-acetyl-5-hexylspiro[2H-indole-3,3'-pyrrolidine]-1-yl)-2-(5-chloro-1,3-thiazol-2-yl)ethanone (PubChem CID 159270722) has the molecular formula C24H30ClN3O2S and a molecular weight of 460.04 g/mol. Its IUPAC name is 1-(1'-acetyl-5-hexylspiro[2H-indole-3,3'-pyrrolidine]-1-yl)-2-(5-chloro-1,3-thiazol-2-yl)ethanone.
| Compound Name | 1-(1'-acetyl-5-hexylspiro[2H-indole-3,3'-pyrrolidine]-1-yl)-2-(5-chloro-1,3-thiazol-2-yl)ethanone |
|---|---|
| PubChem CID | 159270722 |
| Molecular Formula | C24H30ClN3O2S |
| Molecular Weight | 460.04 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | 1-(1'-acetyl-5-hexylspiro[2H-indole-3,3'-pyrrolidine]-1-yl)-2-(5-chloro-1,3-thiazol-2-yl)ethanone |
| SMILES | CCCCCCc1ccc2c(c1)C1(CCN(C(C)=O)C1)CN2C(=O)Cc1ncc(Cl)s1 |
| InChI | InChI=1S/C24H30ClN3O2S/c1-3-4-5-6-7-18-8-9-20-19(12-18)24(10-11-27(15-24)17(2)29)16-28(20)23(30)13-22-26-14-21(25)31-22/h8-9,12,14H,3-7,10-11,13,15-16H2,1-2H3 |
| InChIKey | XWZVHBFZPBOEFF-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.04 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|