C21H24N4 — CID 159273056
3,5-diphenyl-1H-pyrazolo[4,3-d]pyrimidine;ethane (PubChem CID 159273056) has the molecular formula C21H24N4 and a molecular weight of 332.45 g/mol. Its IUPAC name is 3,5-diphenyl-1H-pyrazolo[4,3-d]pyrimidine;ethane.
| Compound Name | 3,5-diphenyl-1H-pyrazolo[4,3-d]pyrimidine;ethane |
|---|---|
| PubChem CID | 159273056 |
| Molecular Formula | C21H24N4 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | 3,5-diphenyl-1H-pyrazolo[4,3-d]pyrimidine;ethane |
| SMILES | CC.CC.c1ccc(-c2ncc3[nH]nc(-c4ccccc4)c3n2)cc1 |
| InChI | InChI=1S/C17H12N4.2C2H6/c1-3-7-12(8-4-1)15-16-14(20-21-15)11-18-17(19-16)13-9-5-2-6-10-13;2*1-2/h1-11H,(H,20,21);2*1-2H3 |
| InChIKey | KXYLOBMWYLZOQK-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |