C22H25N3 — CID 160775016
3,5-diphenyl-1H-pyrazolo[4,3-b]pyridine;ethane (PubChem CID 160775016) has the molecular formula C22H25N3 and a molecular weight of 331.46 g/mol. Its IUPAC name is 3,5-diphenyl-1H-pyrazolo[4,3-b]pyridine;ethane.
| Compound Name | 3,5-diphenyl-1H-pyrazolo[4,3-b]pyridine;ethane |
|---|---|
| PubChem CID | 160775016 |
| Molecular Formula | C22H25N3 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.20 |
| IUPAC Name | 3,5-diphenyl-1H-pyrazolo[4,3-b]pyridine;ethane |
| SMILES | CC.CC.c1ccc(-c2ccc3[nH]nc(-c4ccccc4)c3n2)cc1 |
| InChI | InChI=1S/C18H13N3.2C2H6/c1-3-7-13(8-4-1)15-11-12-16-18(19-15)17(21-20-16)14-9-5-2-6-10-14;2*1-2/h1-12H,(H,20,21);2*1-2H3 |
| InChIKey | RZVFCSFDPSUEQA-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |