C11H24N2O — CID 159273198
1,3-dimethyl-1-(3-methylbutyl)-3-propan-2-ylurea (PubChem CID 159273198) has the molecular formula C11H24N2O and a molecular weight of 200.33 g/mol. Its IUPAC name is 1,3-dimethyl-1-(3-methylbutyl)-3-propan-2-ylurea.
| Compound Name | 1,3-dimethyl-1-(3-methylbutyl)-3-propan-2-ylurea |
|---|---|
| PubChem CID | 159273198 |
| Molecular Formula | C11H24N2O |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.19 |
| IUPAC Name | 1,3-dimethyl-1-(3-methylbutyl)-3-propan-2-ylurea |
| SMILES | CC(C)CCN(C)C(=O)N(C)C(C)C |
| InChI | InChI=1S/C11H24N2O/c1-9(2)7-8-12(5)11(14)13(6)10(3)4/h9-10H,7-8H2,1-6H3 |
| InChIKey | YFHZBEYDFMSHAK-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |