C10H20ClNO — CID 62728337
3-chloro-N,2-dimethyl-N-(3-methylbutyl)propanamide (PubChem CID 62728337) has the molecular formula C10H20ClNO and a molecular weight of 205.73 g/mol. Its IUPAC name is 3-chloro-N,2-dimethyl-N-(3-methylbutyl)propanamide.
| Compound Name | 3-chloro-N,2-dimethyl-N-(3-methylbutyl)propanamide |
|---|---|
| PubChem CID | 62728337 |
| Molecular Formula | C10H20ClNO |
| Molecular Weight | 205.73 g/mol |
| Exact Mass | 205.12 |
| IUPAC Name | 3-chloro-N,2-dimethyl-N-(3-methylbutyl)propanamide |
| SMILES | CC(C)CCN(C)C(=O)C(C)CCl |
| InChI | InChI=1S/C10H20ClNO/c1-8(2)5-6-12(4)10(13)9(3)7-11/h8-9H,5-7H2,1-4H3 |
| InChIKey | SLJGPDZPJFGQJC-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.73 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|