C41H44F3N5O3 — CID 159276403
4-ethynyl-N-[4-(2-piperidin-2-ylethyl)phenyl]benzamide;N-(4-piperidin-3-ylphenyl)-6-(2,2,2-trifluoroethoxy)pyridine-3-carboxamide (PubChem CID 159276403) has the molecular formula C41H44F3N5O3 and a molecular weight of 711.83 g/mol. Its IUPAC name is 4-ethynyl-N-[4-(2-piperidin-2-ylethyl)phenyl]benzamide;N-(4-piperidin-3-ylphenyl)-6-(2,2,2-trifluoroethoxy)pyridine-3-carboxamide.
| Compound Name | 4-ethynyl-N-[4-(2-piperidin-2-ylethyl)phenyl]benzamide;N-(4-piperidin-3-ylphenyl)-6-(2,2,2-trifluoroethoxy)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 159276403 |
| Molecular Formula | C41H44F3N5O3 |
| Molecular Weight | 711.83 g/mol |
| Exact Mass | 711.34 |
| IUPAC Name | 4-ethynyl-N-[4-(2-piperidin-2-ylethyl)phenyl]benzamide;N-(4-piperidin-3-ylphenyl)-6-(2,2,2-trifluoroethoxy)pyridine-3-carboxamide |
| SMILES | C#Cc1ccc(C(=O)Nc2ccc(CCC3CCCCN3)cc2)cc1.O=C(Nc1ccc(C2CCCNC2)cc1)c1ccc(OCC(F)(F)F)nc1 |
| InChI | InChI=1S/C22H24N2O.C19H20F3N3O2/c1-2-17-6-11-19(12-7-17)22(25)24-21-14-9-18(10-15-21)8-13-20-5-3-4-16-23-20;20-19(21,22)12-27-17-8-5-15(11-24-17)18(26)25-16-6-3-13(4-7-16)14-2-1-9-23-10-14/h1,6-7,9-12,14-15,20,23H,3-5,8,13,16H2,(H,24,25);3-8,11,14,23H,1-2,9-10,12H2,(H,25,26) |
| InChIKey | KYIZTVJPNGDFBK-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 104.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.83 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|