C26H16ClF3N2O4 — CID 159278725
3-[(6-carboxyindol-1-ium-3-ylidene)-[4-(trifluoromethyl)phenyl]methyl]-1H-indole-6-carboxylic acid chloride (PubChem CID 159278725) has the molecular formula C26H16ClF3N2O4 and a molecular weight of 512.87 g/mol. Its IUPAC name is 3-[(6-carboxyindol-1-ium-3-ylidene)-[4-(trifluoromethyl)phenyl]methyl]-1H-indole-6-carboxylic acid chloride.
| Compound Name | 3-[(6-carboxyindol-1-ium-3-ylidene)-[4-(trifluoromethyl)phenyl]methyl]-1H-indole-6-carboxylic acid chloride |
|---|---|
| PubChem CID | 159278725 |
| Molecular Formula | C26H16ClF3N2O4 |
| Molecular Weight | 512.87 g/mol |
| Exact Mass | 512.08 |
| IUPAC Name | 3-[(6-carboxyindol-1-ium-3-ylidene)-[4-(trifluoromethyl)phenyl]methyl]-1H-indole-6-carboxylic acid chloride |
| SMILES | O=C(O)c1ccc2c(c1)[NH+]=CC2=C(c1ccc(C(F)(F)F)cc1)c1c[nH]c2cc(C(=O)O)ccc12.[Cl-] |
| InChI | InChI=1S/C26H15F3N2O4.ClH/c27-26(28,29)16-5-1-13(2-6-16)23(19-11-30-21-9-14(24(32)33)3-7-17(19)21)20-12-31-22-10-15(25(34)35)4-8-18(20)22;/h1-12,30H,(H,32,33)(H,34,35);1H |
| InChIKey | OIQAOQGAOLAAFA-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 104.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.87 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|