C24H23BN3O+ — CID 159282180
5,11-dimethyl-6-[1-methyl-4-phenyl-5-(trideuteriomethyl)pyridin-1-ium-2-yl]-8-oxa-6,10-diaza-5-boratricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaene (PubChem CID 159282180) has the molecular formula C24H23BN3O+ and a molecular weight of 383.30 g/mol. Its IUPAC name is 5,11-dimethyl-6-[1-methyl-4-phenyl-5-(trideuteriomethyl)pyridin-1-ium-2-yl]-8-oxa-6,10-diaza-5-boratricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaene.
| Compound Name | 5,11-dimethyl-6-[1-methyl-4-phenyl-5-(trideuteriomethyl)pyridin-1-ium-2-yl]-8-oxa-6,10-diaza-5-boratricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaene |
|---|---|
| PubChem CID | 159282180 |
| Molecular Formula | C24H23BN3O+ |
| Molecular Weight | 383.30 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | 5,11-dimethyl-6-[1-methyl-4-phenyl-5-(trideuteriomethyl)pyridin-1-ium-2-yl]-8-oxa-6,10-diaza-5-boratricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaene |
| SMILES | [2H]C([2H])([2H])c1c[n+](C)c(N2B(C)C=Cc3c2oc2nc(C)ccc32)cc1-c1ccccc1 |
| InChI | InChI=1S/C24H23BN3O/c1-16-15-27(4)22(14-21(16)18-8-6-5-7-9-18)28-24-20(12-13-25(28)3)19-11-10-17(2)26-23(19)29-24/h5-15H,1-4H3/q+1/i1D3 |
| InChIKey | WJRKRZWZEGRETK-FIBGUPNXSA-N |
| XLogP | 5.26 |
| TPSA | 33.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.30 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|