C39H35BN3+ — CID 166043800
2-(2,6-diphenylphenyl)-4-methyl-3-[1-methyl-4,5-bis(trideuteriomethyl)pyridin-1-ium-2-yl]-1-phenyl-1,3,2-benzodiazaborole (PubChem CID 166043800) has the molecular formula C39H35BN3+ and a molecular weight of 562.58 g/mol. Its IUPAC name is 2-(2,6-diphenylphenyl)-4-methyl-3-[1-methyl-4,5-bis(trideuteriomethyl)pyridin-1-ium-2-yl]-1-phenyl-1,3,2-benzodiazaborole.
| Compound Name | 2-(2,6-diphenylphenyl)-4-methyl-3-[1-methyl-4,5-bis(trideuteriomethyl)pyridin-1-ium-2-yl]-1-phenyl-1,3,2-benzodiazaborole |
|---|---|
| PubChem CID | 166043800 |
| Molecular Formula | C39H35BN3+ |
| Molecular Weight | 562.58 g/mol |
| Exact Mass | 562.33 |
| IUPAC Name | 2-(2,6-diphenylphenyl)-4-methyl-3-[1-methyl-4,5-bis(trideuteriomethyl)pyridin-1-ium-2-yl]-1-phenyl-1,3,2-benzodiazaborole |
| SMILES | [2H]C([2H])([2H])c1cc(N2B(c3c(-c4ccccc4)cccc3-c3ccccc3)N(c3ccccc3)c3cccc(C)c32)[n+](C)cc1C([2H])([2H])[2H] |
| InChI | InChI=1S/C39H35BN3/c1-28-16-14-25-36-39(28)43(37-26-29(2)30(3)27-41(37)4)40(42(36)33-21-12-7-13-22-33)38-34(31-17-8-5-9-18-31)23-15-24-35(38)32-19-10-6-11-20-32/h5-27H,1-4H3/q+1/i2D3,3D3 |
| InChIKey | HCVCNDYFPBBJTF-XERRXZQWSA-N |
| XLogP | 8.46 |
| TPSA | 10.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.58 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|