C28H29BN3+ — CID 167400618
2-(2,6-dimethylphenyl)-4,7-dimethyl-3-(1-methylpyridin-1-ium-2-yl)-1-phenyl-1,3,2-benzodiazaborole (PubChem CID 167400618) has the molecular formula C28H29BN3+ and a molecular weight of 418.37 g/mol. Its IUPAC name is 2-(2,6-dimethylphenyl)-4,7-dimethyl-3-(1-methylpyridin-1-ium-2-yl)-1-phenyl-1,3,2-benzodiazaborole.
| Compound Name | 2-(2,6-dimethylphenyl)-4,7-dimethyl-3-(1-methylpyridin-1-ium-2-yl)-1-phenyl-1,3,2-benzodiazaborole |
|---|---|
| PubChem CID | 167400618 |
| Molecular Formula | C28H29BN3+ |
| Molecular Weight | 418.37 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | 2-(2,6-dimethylphenyl)-4,7-dimethyl-3-(1-methylpyridin-1-ium-2-yl)-1-phenyl-1,3,2-benzodiazaborole |
| SMILES | Cc1cccc(C)c1B1N(c2ccccc2)c2c(C)ccc(C)c2N1c1cccc[n+]1C |
| InChI | InChI=1S/C28H29BN3/c1-20-12-11-13-21(2)26(20)29-31(24-14-7-6-8-15-24)27-22(3)17-18-23(4)28(27)32(29)25-16-9-10-19-30(25)5/h6-19H,1-5H3/q+1 |
| InChIKey | GDXVSZCIJFSQGR-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 10.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.37 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|