C16H19N2O+ — CID 171436244
9-methyl-1-(1-methylpyridin-1-ium-2-yl)-3,5-dihydro-2H-4,1-benzoxazepine (PubChem CID 171436244) has the molecular formula C16H19N2O+ and a molecular weight of 255.34 g/mol. Its IUPAC name is 9-methyl-1-(1-methylpyridin-1-ium-2-yl)-3,5-dihydro-2H-4,1-benzoxazepine.
| Compound Name | 9-methyl-1-(1-methylpyridin-1-ium-2-yl)-3,5-dihydro-2H-4,1-benzoxazepine |
|---|---|
| PubChem CID | 171436244 |
| Molecular Formula | C16H19N2O+ |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | 9-methyl-1-(1-methylpyridin-1-ium-2-yl)-3,5-dihydro-2H-4,1-benzoxazepine |
| SMILES | Cc1cccc2c1N(c1cccc[n+]1C)CCOC2 |
| InChI | InChI=1S/C16H19N2O/c1-13-6-5-7-14-12-19-11-10-18(16(13)14)15-8-3-4-9-17(15)2/h3-9H,10-12H2,1-2H3/q+1 |
| InChIKey | WHYYBZWXOOVAIE-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 16.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|