C19H16BN2O+ — CID 156623220
12,16-dimethyl-21-oxa-14-aza-12-azonia-1-borapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-2,4,6,8(13),9,11,15,17,19-nonaene (PubChem CID 156623220) has the molecular formula C19H16BN2O+ and a molecular weight of 299.16 g/mol. Its IUPAC name is 12,16-dimethyl-21-oxa-14-aza-12-azonia-1-borapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-2,4,6,8(13),9,11,15,17,19-nonaene.
| Compound Name | 12,16-dimethyl-21-oxa-14-aza-12-azonia-1-borapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-2,4,6,8(13),9,11,15,17,19-nonaene |
|---|---|
| PubChem CID | 156623220 |
| Molecular Formula | C19H16BN2O+ |
| Molecular Weight | 299.16 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | 12,16-dimethyl-21-oxa-14-aza-12-azonia-1-borapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-2,4,6,8(13),9,11,15,17,19-nonaene |
| SMILES | Cc1cccc2c1N1B(O2)c2ccccc2-c2ccc[n+](C)c21 |
| InChI | InChI=1S/C19H16BN2O/c1-13-7-5-11-17-18(13)22-19-15(9-6-12-21(19)2)14-8-3-4-10-16(14)20(22)23-17/h3-12H,1-2H3/q+1 |
| InChIKey | YQSLVJJAOOGHRF-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 16.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.16 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|