C24H23B2NO3 — CID 156665748
10-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-21-oxa-14-aza-1-borapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-2,4,6,8(13),9,11,15,17,19-nonaene (PubChem CID 156665748) has the molecular formula C24H23B2NO3 and a molecular weight of 395.08 g/mol. Its IUPAC name is 10-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-21-oxa-14-aza-1-borapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-2,4,6,8(13),9,11,15,17,19-nonaene.
| Compound Name | 10-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-21-oxa-14-aza-1-borapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-2,4,6,8(13),9,11,15,17,19-nonaene |
|---|---|
| PubChem CID | 156665748 |
| Molecular Formula | C24H23B2NO3 |
| Molecular Weight | 395.08 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | 10-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-21-oxa-14-aza-1-borapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-2,4,6,8(13),9,11,15,17,19-nonaene |
| SMILES | CC1(C)OB(c2ccc3c(c2)-c2ccccc2B2Oc4ccccc4N23)OC1(C)C |
| InChI | InChI=1S/C24H23B2NO3/c1-23(2)24(3,4)30-26(29-23)16-13-14-20-18(15-16)17-9-5-6-10-19(17)25-27(20)21-11-7-8-12-22(21)28-25/h5-15H,1-4H3 |
| InChIKey | QJHGXOYVZZDTNK-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.08 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|