C15H27NO4 — CID 15928568
(E,2R,5S)-2,7-dimethyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]oct-3-enoic acid (PubChem CID 15928568) has the molecular formula C15H27NO4 and a molecular weight of 285.38 g/mol. Its IUPAC name is (E,2R,5S)-2,7-dimethyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]oct-3-enoic acid.
| Compound Name | (E,2R,5S)-2,7-dimethyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]oct-3-enoic acid |
|---|---|
| PubChem CID | 15928568 |
| Molecular Formula | C15H27NO4 |
| Molecular Weight | 285.38 g/mol |
| Exact Mass | 285.19 |
| IUPAC Name | (E,2R,5S)-2,7-dimethyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]oct-3-enoic acid |
| SMILES | CC(C)C[C@@H](/C=C/[C@@H](C)C(=O)O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H27NO4/c1-10(2)9-12(8-7-11(3)13(17)18)16-14(19)20-15(4,5)6/h7-8,10-12H,9H2,1-6H3,(H,16,19)(H,17,18)/b8-7+/t11-,12-/m1/s1 |
| InChIKey | UUGNJJSSUXHGCO-IDDPWSFUSA-N |
| XLogP | 3.20 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.38 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|