C16H30N2O3 — CID 164848968
tert-butyl N-[(E,4S)-8-amino-2,7,7-trimethyl-8-oxooct-5-en-4-yl]carbamate (PubChem CID 164848968) has the molecular formula C16H30N2O3 and a molecular weight of 298.43 g/mol. Its IUPAC name is tert-butyl N-[(E,4S)-8-amino-2,7,7-trimethyl-8-oxooct-5-en-4-yl]carbamate.
| Compound Name | tert-butyl N-[(E,4S)-8-amino-2,7,7-trimethyl-8-oxooct-5-en-4-yl]carbamate |
|---|---|
| PubChem CID | 164848968 |
| Molecular Formula | C16H30N2O3 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.23 |
| IUPAC Name | tert-butyl N-[(E,4S)-8-amino-2,7,7-trimethyl-8-oxooct-5-en-4-yl]carbamate |
| SMILES | CC(C)C[C@@H](/C=C/C(C)(C)C(N)=O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H30N2O3/c1-11(2)10-12(8-9-16(6,7)13(17)19)18-14(20)21-15(3,4)5/h8-9,11-12H,10H2,1-7H3,(H2,17,19)(H,18,20)/b9-8+/t12-/m1/s1 |
| InChIKey | KOKQYWVRWFFGBN-IDVQTMNDSA-N |
| XLogP | 2.99 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|