C34H30N6O — CID 159286132
2-(2-methylphenyl)-1H-indol-6-amine;N-[2-(2-methylphenyl)-1H-indol-6-yl]-1H-pyrazole-5-carboxamide (PubChem CID 159286132) has the molecular formula C34H30N6O and a molecular weight of 538.66 g/mol. Its IUPAC name is 2-(2-methylphenyl)-1H-indol-6-amine;N-[2-(2-methylphenyl)-1H-indol-6-yl]-1H-pyrazole-5-carboxamide.
| Compound Name | 2-(2-methylphenyl)-1H-indol-6-amine;N-[2-(2-methylphenyl)-1H-indol-6-yl]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 159286132 |
| Molecular Formula | C34H30N6O |
| Molecular Weight | 538.66 g/mol |
| Exact Mass | 538.25 |
| IUPAC Name | 2-(2-methylphenyl)-1H-indol-6-amine;N-[2-(2-methylphenyl)-1H-indol-6-yl]-1H-pyrazole-5-carboxamide |
| SMILES | Cc1ccccc1-c1cc2ccc(N)cc2[nH]1.Cc1ccccc1-c1cc2ccc(NC(=O)c3ccn[nH]3)cc2[nH]1 |
| InChI | InChI=1S/C19H16N4O.C15H14N2/c1-12-4-2-3-5-15(12)18-10-13-6-7-14(11-17(13)22-18)21-19(24)16-8-9-20-23-16;1-10-4-2-3-5-13(10)15-8-11-6-7-12(16)9-14(11)17-15/h2-11,22H,1H3,(H,20,23)(H,21,24);2-9,17H,16H2,1H3 |
| InChIKey | KZNLKUBWNUAGCA-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 115.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.66 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|