About methane;octyl sulfite
methane;octyl sulfite (PubChem CID 159287523) has the molecular formula C9H21O3S-
and a molecular weight of 209.33 g/mol. Its IUPAC name is methane;octyl sulfite.
Molecular Properties
| Compound Name | methane;octyl sulfite |
| PubChem CID | 159287523 |
| Molecular Formula | C9H21O3S- |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | methane;octyl sulfite |
| SMILES | C.CCCCCCCCOS(=O)[O-] |
| InChI | InChI=1S/C8H18O3S.CH4/c1-2-3-4-5-6-7-8-11-12(9)10;/h2-8H2,1H3,(H,9,10);1H4/p-1 |
| InChIKey | KZRVCWUQUCOGOV-UHFFFAOYSA-M |
| XLogP | 2.79 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze methane;octyl sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;octyl sulfite?
The IUPAC name of methane;octyl sulfite (CID 159287523) is methane;octyl sulfite.
What is the SMILES notation for methane;octyl sulfite?
The canonical SMILES for methane;octyl sulfite is C.CCCCCCCCOS(=O)[O-].
What is the InChIKey of methane;octyl sulfite?
The InChIKey is KZRVCWUQUCOGOV-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H18O3S.CH4/c1-2-3-4-5-6-7-8-11-12(9)10;/h2-8H2,1H3,(H,9,10);1H4/p-1.
What are the key properties of methane;octyl sulfite?
methane;octyl sulfite has a molecular weight of 209.33 g/mol, XLogP of 2.79, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methane;octyl sulfite is sourced from PubChem (CID 159287523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).