About 5-aminopentyl sulfite
5-aminopentyl sulfite (PubChem CID 57200749) has the molecular formula C5H12NO3S-
and a molecular weight of 166.22 g/mol. Its IUPAC name is 5-aminopentyl sulfite.
Molecular Properties
| Compound Name | 5-aminopentyl sulfite |
| PubChem CID | 57200749 |
| Molecular Formula | C5H12NO3S- |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.05 |
| IUPAC Name | 5-aminopentyl sulfite |
| SMILES | NCCCCCOS(=O)[O-] |
| InChI | InChI=1S/C5H13NO3S/c6-4-2-1-3-5-9-10(7)8/h1-6H2,(H,7,8)/p-1 |
| InChIKey | QSEFQSSHDCEOEP-UHFFFAOYSA-M |
| XLogP | -0.07 |
| TPSA | 75.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 5-aminopentyl sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-aminopentyl sulfite?
The IUPAC name of 5-aminopentyl sulfite (CID 57200749) is 5-aminopentyl sulfite.
What is the SMILES notation for 5-aminopentyl sulfite?
The canonical SMILES for 5-aminopentyl sulfite is NCCCCCOS(=O)[O-].
What is the InChIKey of 5-aminopentyl sulfite?
The InChIKey is QSEFQSSHDCEOEP-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H13NO3S/c6-4-2-1-3-5-9-10(7)8/h1-6H2,(H,7,8)/p-1.
What are the key properties of 5-aminopentyl sulfite?
5-aminopentyl sulfite has a molecular weight of 166.22 g/mol, XLogP of -0.07, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-aminopentyl sulfite is sourced from PubChem (CID 57200749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).