About sodium;hex-5-enyl sulfite;hydride
sodium;hex-5-enyl sulfite;hydride (PubChem CID 174851694) has the molecular formula C6H12NaO3S-
and a molecular weight of 187.22 g/mol. Its IUPAC name is sodium;hex-5-enyl sulfite;hydride.
Molecular Properties
| Compound Name | sodium;hex-5-enyl sulfite;hydride |
| PubChem CID | 174851694 |
| Molecular Formula | C6H12NaO3S- |
| Molecular Weight | 187.22 g/mol |
| Exact Mass | 187.04 |
| IUPAC Name | sodium;hex-5-enyl sulfite;hydride |
| SMILES | C=CCCCCOS(=O)[O-].[H-].[Na+] |
| InChI | InChI=1S/C6H12O3S.Na.H/c1-2-3-4-5-6-9-10(7)8;;/h2H,1,3-6H2,(H,7,8);;/q;+1;-1/p-1 |
| InChIKey | ADAFLXZUUCRMEN-UHFFFAOYSA-M |
| XLogP | -1.73 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.22 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze sodium;hex-5-enyl sulfite;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hex-5-enyl sulfite;hydride?
The IUPAC name of sodium;hex-5-enyl sulfite;hydride (CID 174851694) is sodium;hex-5-enyl sulfite;hydride.
What is the SMILES notation for sodium;hex-5-enyl sulfite;hydride?
The canonical SMILES for sodium;hex-5-enyl sulfite;hydride is C=CCCCCOS(=O)[O-].[H-].[Na+].
What is the InChIKey of sodium;hex-5-enyl sulfite;hydride?
The InChIKey is ADAFLXZUUCRMEN-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H12O3S.Na.H/c1-2-3-4-5-6-9-10(7)8;;/h2H,1,3-6H2,(H,7,8);;/q;+1;-1/p-1.
What are the key properties of sodium;hex-5-enyl sulfite;hydride?
sodium;hex-5-enyl sulfite;hydride has a molecular weight of 187.22 g/mol, XLogP of -1.73, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hex-5-enyl sulfite;hydride is sourced from PubChem (CID 174851694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).