About 3-oxopent-4-enyl sulfite
3-oxopent-4-enyl sulfite (PubChem CID 91149708) has the molecular formula C5H7O4S-
and a molecular weight of 163.17 g/mol. Its IUPAC name is 3-oxopent-4-enyl sulfite.
Molecular Properties
| Compound Name | 3-oxopent-4-enyl sulfite |
| PubChem CID | 91149708 |
| Molecular Formula | C5H7O4S- |
| Molecular Weight | 163.17 g/mol |
| Exact Mass | 163.01 |
| IUPAC Name | 3-oxopent-4-enyl sulfite |
| SMILES | C=CC(=O)CCOS(=O)[O-] |
| InChI | InChI=1S/C5H8O4S/c1-2-5(6)3-4-9-10(7)8/h2H,1,3-4H2,(H,7,8)/p-1 |
| InChIKey | UEBYNOMLZLABAA-UHFFFAOYSA-M |
| XLogP | -0.06 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.17 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 3-oxopent-4-enyl sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-oxopent-4-enyl sulfite?
The IUPAC name of 3-oxopent-4-enyl sulfite (CID 91149708) is 3-oxopent-4-enyl sulfite.
What is the SMILES notation for 3-oxopent-4-enyl sulfite?
The canonical SMILES for 3-oxopent-4-enyl sulfite is C=CC(=O)CCOS(=O)[O-].
What is the InChIKey of 3-oxopent-4-enyl sulfite?
The InChIKey is UEBYNOMLZLABAA-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H8O4S/c1-2-5(6)3-4-9-10(7)8/h2H,1,3-4H2,(H,7,8)/p-1.
What are the key properties of 3-oxopent-4-enyl sulfite?
3-oxopent-4-enyl sulfite has a molecular weight of 163.17 g/mol, XLogP of -0.06, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-oxopent-4-enyl sulfite is sourced from PubChem (CID 91149708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).