C25H25F3O3 — CID 159288988
4-[3-[(2,4-difluorophenyl)methoxy]-5-[(2-fluoro-4-methylphenyl)methoxy]phenyl]butan-1-ol (PubChem CID 159288988) has the molecular formula C25H25F3O3 and a molecular weight of 430.47 g/mol. Its IUPAC name is 4-[3-[(2,4-difluorophenyl)methoxy]-5-[(2-fluoro-4-methylphenyl)methoxy]phenyl]butan-1-ol.
| Compound Name | 4-[3-[(2,4-difluorophenyl)methoxy]-5-[(2-fluoro-4-methylphenyl)methoxy]phenyl]butan-1-ol |
|---|---|
| PubChem CID | 159288988 |
| Molecular Formula | C25H25F3O3 |
| Molecular Weight | 430.47 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | 4-[3-[(2,4-difluorophenyl)methoxy]-5-[(2-fluoro-4-methylphenyl)methoxy]phenyl]butan-1-ol |
| SMILES | Cc1ccc(COc2cc(CCCCO)cc(OCc3ccc(F)cc3F)c2)c(F)c1 |
| InChI | InChI=1S/C25H25F3O3/c1-17-5-6-19(24(27)10-17)15-30-22-11-18(4-2-3-9-29)12-23(14-22)31-16-20-7-8-21(26)13-25(20)28/h5-8,10-14,29H,2-4,9,15-16H2,1H3 |
| InChIKey | URCZCNMEYZDFRD-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.47 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|